C22H19F6NO3 — CID 146391315
[2,2,3,3,4,4-hexafluoro-5-(1-methyl-2-phenylindol-6-yl)oxypentyl] acetate (PubChem CID 146391315) has the molecular formula C22H19F6NO3 and a molecular weight of 459.39 g/mol. Its IUPAC name is [2,2,3,3,4,4-hexafluoro-5-(1-methyl-2-phenylindol-6-yl)oxypentyl] acetate.
| Compound Name | [2,2,3,3,4,4-hexafluoro-5-(1-methyl-2-phenylindol-6-yl)oxypentyl] acetate |
|---|---|
| PubChem CID | 146391315 |
| Molecular Formula | C22H19F6NO3 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [2,2,3,3,4,4-hexafluoro-5-(1-methyl-2-phenylindol-6-yl)oxypentyl] acetate |
| SMILES | CC(=O)OCC(F)(F)C(F)(F)C(F)(F)COc1ccc2cc(-c3ccccc3)n(C)c2c1 |
| InChI | InChI=1S/C22H19F6NO3/c1-14(30)31-12-20(23,24)22(27,28)21(25,26)13-32-17-9-8-16-10-18(29(2)19(16)11-17)15-6-4-3-5-7-15/h3-11H,12-13H2,1-2H3 |
| InChIKey | FEZXNCRQOKEXKQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|