C28H32F3NO5S — CID 155005074
[4,5-dihydroxy-8-[1-methyl-2-[4-methyl-2-(trifluoromethoxy)phenyl]indol-6-yl]sulfanyloctyl] prop-2-enoate (PubChem CID 155005074) has the molecular formula C28H32F3NO5S and a molecular weight of 551.63 g/mol. Its IUPAC name is [4,5-dihydroxy-8-[1-methyl-2-[4-methyl-2-(trifluoromethoxy)phenyl]indol-6-yl]sulfanyloctyl] prop-2-enoate.
| Compound Name | [4,5-dihydroxy-8-[1-methyl-2-[4-methyl-2-(trifluoromethoxy)phenyl]indol-6-yl]sulfanyloctyl] prop-2-enoate |
|---|---|
| PubChem CID | 155005074 |
| Molecular Formula | C28H32F3NO5S |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | [4,5-dihydroxy-8-[1-methyl-2-[4-methyl-2-(trifluoromethoxy)phenyl]indol-6-yl]sulfanyloctyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCC(O)C(O)CCCSc1ccc2cc(-c3ccc(C)cc3OC(F)(F)F)n(C)c2c1 |
| InChI | InChI=1S/C28H32F3NO5S/c1-4-27(35)36-13-5-7-24(33)25(34)8-6-14-38-20-11-10-19-16-23(32(3)22(19)17-20)21-12-9-18(2)15-26(21)37-28(29,30)31/h4,9-12,15-17,24-25,33-34H,1,5-8,13-14H2,2-3H3 |
| InChIKey | JYRAQKKYHSQQIJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|