C48H44O5S2 — CID 167346090
4-[4-[2-[3-methyl-4-[[4-[2-[6-(4-prop-2-enoyloxybutylsulfanyl)naphthalen-2-yl]ethynyl]phenyl]methoxy]phenyl]ethynyl]phenyl]sulfanylbutyl prop-2-enoate (PubChem CID 167346090) has the molecular formula C48H44O5S2 and a molecular weight of 765.01 g/mol. Its IUPAC name is 4-[4-[2-[3-methyl-4-[[4-[2-[6-(4-prop-2-enoyloxybutylsulfanyl)naphthalen-2-yl]ethynyl]phenyl]methoxy]phenyl]ethynyl]phenyl]sulfanylbutyl prop-2-enoate.
| Compound Name | 4-[4-[2-[3-methyl-4-[[4-[2-[6-(4-prop-2-enoyloxybutylsulfanyl)naphthalen-2-yl]ethynyl]phenyl]methoxy]phenyl]ethynyl]phenyl]sulfanylbutyl prop-2-enoate |
|---|---|
| PubChem CID | 167346090 |
| Molecular Formula | C48H44O5S2 |
| Molecular Weight | 765.01 g/mol |
| Exact Mass | 764.26 |
| IUPAC Name | 4-[4-[2-[3-methyl-4-[[4-[2-[6-(4-prop-2-enoyloxybutylsulfanyl)naphthalen-2-yl]ethynyl]phenyl]methoxy]phenyl]ethynyl]phenyl]sulfanylbutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCSc1ccc(C#Cc2ccc(OCc3ccc(C#Cc4ccc5cc(SCCCCOC(=O)C=C)ccc5c4)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C48H44O5S2/c1-4-47(49)51-28-6-8-30-54-44-24-19-38(20-25-44)10-14-39-21-27-46(36(3)32-39)53-35-41-16-12-37(13-17-41)11-15-40-18-22-43-34-45(26-23-42(43)33-40)55-31-9-7-29-52-48(50)5-2/h4-5,12-13,16-27,32-34H,1-2,6-9,28-31,35H2,3H3 |
| InChIKey | FOLZNWRZTSCXPK-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.01 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|