C44H33NO5S2 — CID 171608166
2-[4-[2-[6-[[2-isocyano-4-[2-[4-(2-prop-2-enoyloxyethylsulfanyl)phenyl]ethynyl]phenoxy]methyl]naphthalen-2-yl]ethynyl]phenyl]sulfanylethyl prop-2-enoate (PubChem CID 171608166) has the molecular formula C44H33NO5S2 and a molecular weight of 719.88 g/mol. Its IUPAC name is 2-[4-[2-[6-[[2-isocyano-4-[2-[4-(2-prop-2-enoyloxyethylsulfanyl)phenyl]ethynyl]phenoxy]methyl]naphthalen-2-yl]ethynyl]phenyl]sulfanylethyl prop-2-enoate.
| Compound Name | 2-[4-[2-[6-[[2-isocyano-4-[2-[4-(2-prop-2-enoyloxyethylsulfanyl)phenyl]ethynyl]phenoxy]methyl]naphthalen-2-yl]ethynyl]phenyl]sulfanylethyl prop-2-enoate |
|---|---|
| PubChem CID | 171608166 |
| Molecular Formula | C44H33NO5S2 |
| Molecular Weight | 719.88 g/mol |
| Exact Mass | 719.18 |
| IUPAC Name | 2-[4-[2-[6-[[2-isocyano-4-[2-[4-(2-prop-2-enoyloxyethylsulfanyl)phenyl]ethynyl]phenoxy]methyl]naphthalen-2-yl]ethynyl]phenyl]sulfanylethyl prop-2-enoate |
| SMILES | [C-]#[N+]c1cc(C#Cc2ccc(SCCOC(=O)C=C)cc2)ccc1OCc1ccc2cc(C#Cc3ccc(SCCOC(=O)C=C)cc3)ccc2c1 |
| InChI | InChI=1S/C44H33NO5S2/c1-4-43(46)48-24-26-51-39-19-12-32(13-20-39)6-8-34-10-17-38-29-36(11-18-37(38)28-34)31-50-42-23-16-35(30-41(42)45-3)9-7-33-14-21-40(22-15-33)52-27-25-49-44(47)5-2/h4-5,10-23,28-30H,1-2,24-27,31H2 |
| InChIKey | PMKQOFWUBKNHPD-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 66.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.88 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|