C41H36O4S2 — CID 167346094
2-[4-[2-[4-[[3-methyl-4-[2-[2-methyl-4-(2-prop-2-enoyloxyethylsulfanyl)phenyl]ethynyl]phenyl]methylsulfanyl]phenyl]ethynyl]phenyl]ethyl prop-2-enoate (PubChem CID 167346094) has the molecular formula C41H36O4S2 and a molecular weight of 656.87 g/mol. Its IUPAC name is 2-[4-[2-[4-[[3-methyl-4-[2-[2-methyl-4-(2-prop-2-enoyloxyethylsulfanyl)phenyl]ethynyl]phenyl]methylsulfanyl]phenyl]ethynyl]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-[2-[4-[[3-methyl-4-[2-[2-methyl-4-(2-prop-2-enoyloxyethylsulfanyl)phenyl]ethynyl]phenyl]methylsulfanyl]phenyl]ethynyl]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 167346094 |
| Molecular Formula | C41H36O4S2 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.21 |
| IUPAC Name | 2-[4-[2-[4-[[3-methyl-4-[2-[2-methyl-4-(2-prop-2-enoyloxyethylsulfanyl)phenyl]ethynyl]phenyl]methylsulfanyl]phenyl]ethynyl]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCSc1ccc(C#Cc2ccc(CSc3ccc(C#Cc4ccc(CCOC(=O)C=C)cc4)cc3)cc2C)c(C)c1 |
| InChI | InChI=1S/C41H36O4S2/c1-5-40(42)44-24-23-34-11-9-32(10-12-34)7-8-33-14-20-38(21-15-33)47-29-35-13-16-36(30(3)27-35)17-18-37-19-22-39(28-31(37)4)46-26-25-45-41(43)6-2/h5-6,9-16,19-22,27-28H,1-2,23-26,29H2,3-4H3 |
| InChIKey | FVSRPEOUFVUTFK-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|