C19H20O2S3 — CID 90919294
2-[4-(4-ethylsulfanylphenyl)sulfanylphenyl]sulfanylethyl prop-2-enoate (PubChem CID 90919294) has the molecular formula C19H20O2S3 and a molecular weight of 376.57 g/mol. Its IUPAC name is 2-[4-(4-ethylsulfanylphenyl)sulfanylphenyl]sulfanylethyl prop-2-enoate.
| Compound Name | 2-[4-(4-ethylsulfanylphenyl)sulfanylphenyl]sulfanylethyl prop-2-enoate |
|---|---|
| PubChem CID | 90919294 |
| Molecular Formula | C19H20O2S3 |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-[4-(4-ethylsulfanylphenyl)sulfanylphenyl]sulfanylethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCSc1ccc(Sc2ccc(SCC)cc2)cc1 |
| InChI | InChI=1S/C19H20O2S3/c1-3-19(20)21-13-14-23-16-7-11-18(12-8-16)24-17-9-5-15(6-10-17)22-4-2/h3,5-12H,1,4,13-14H2,2H3 |
| InChIKey | YVFZYYCVBRNOQO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|