C18H16O3S2 — CID 67764157
2-[(10-oxo-9H-thioxanthen-2-yl)sulfanyl]ethyl prop-2-enoate (PubChem CID 67764157) has the molecular formula C18H16O3S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[(10-oxo-9H-thioxanthen-2-yl)sulfanyl]ethyl prop-2-enoate.
| Compound Name | 2-[(10-oxo-9H-thioxanthen-2-yl)sulfanyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 67764157 |
| Molecular Formula | C18H16O3S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2-[(10-oxo-9H-thioxanthen-2-yl)sulfanyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCSc1ccc2c(c1)Cc1ccccc1S2=O |
| InChI | InChI=1S/C18H16O3S2/c1-2-18(19)21-9-10-22-15-7-8-17-14(12-15)11-13-5-3-4-6-16(13)23(17)20/h2-8,12H,1,9-11H2 |
| InChIKey | LBKZMMLAKFQMTD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|