C27H32N2O10S3 — CID 163640724
2-[2-[4-[4-[2-(2-acetyloxyethylcarbamoyloxy)ethylsulfanyl]phenyl]sulfonylphenyl]sulfanylethoxycarbonylamino]ethyl prop-2-enoate (PubChem CID 163640724) has the molecular formula C27H32N2O10S3 and a molecular weight of 640.76 g/mol. Its IUPAC name is 2-[2-[4-[4-[2-(2-acetyloxyethylcarbamoyloxy)ethylsulfanyl]phenyl]sulfonylphenyl]sulfanylethoxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[2-[4-[4-[2-(2-acetyloxyethylcarbamoyloxy)ethylsulfanyl]phenyl]sulfonylphenyl]sulfanylethoxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 163640724 |
| Molecular Formula | C27H32N2O10S3 |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.12 |
| IUPAC Name | 2-[2-[4-[4-[2-(2-acetyloxyethylcarbamoyloxy)ethylsulfanyl]phenyl]sulfonylphenyl]sulfanylethoxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCCSc1ccc(S(=O)(=O)c2ccc(SCCOC(=O)NCCOC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C27H32N2O10S3/c1-3-25(31)37-15-13-29-27(33)39-17-19-41-22-6-10-24(11-7-22)42(34,35)23-8-4-21(5-9-23)40-18-16-38-26(32)28-12-14-36-20(2)30/h3-11H,1,12-19H2,2H3,(H,28,32)(H,29,33) |
| InChIKey | IEAJNEDSAPXINO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|