C31H36N2O8S4 — CID 155283600
2-[3-[7-[3-(2-prop-2-enoyloxyethylcarbamoyloxy)propylsulfanyl]thianthren-2-yl]sulfanylpropoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 155283600) has the molecular formula C31H36N2O8S4 and a molecular weight of 692.90 g/mol. Its IUPAC name is 2-[3-[7-[3-(2-prop-2-enoyloxyethylcarbamoyloxy)propylsulfanyl]thianthren-2-yl]sulfanylpropoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-[7-[3-(2-prop-2-enoyloxyethylcarbamoyloxy)propylsulfanyl]thianthren-2-yl]sulfanylpropoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155283600 |
| Molecular Formula | C31H36N2O8S4 |
| Molecular Weight | 692.90 g/mol |
| Exact Mass | 692.14 |
| IUPAC Name | 2-[3-[7-[3-(2-prop-2-enoyloxyethylcarbamoyloxy)propylsulfanyl]thianthren-2-yl]sulfanylpropoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCCCSc1ccc2c(c1)Sc1ccc(SCCCOC(=O)NCCOC(=O)C(=C)C)cc1S2 |
| InChI | InChI=1S/C31H36N2O8S4/c1-4-28(34)38-15-11-32-30(36)40-13-5-17-42-22-7-9-24-26(19-22)44-25-10-8-23(20-27(25)45-24)43-18-6-14-41-31(37)33-12-16-39-29(35)21(2)3/h4,7-10,19-20H,1-2,5-6,11-18H2,3H3,(H,32,36)(H,33,37) |
| InChIKey | UGABSKSQHWJMLW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.90 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|