C23H18N2O2S2 — CID 169065582
3-[9-(dicyanomethylidene)thioxanthen-3-yl]sulfanylpropyl 2-methylprop-2-enoate (PubChem CID 169065582) has the molecular formula C23H18N2O2S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 3-[9-(dicyanomethylidene)thioxanthen-3-yl]sulfanylpropyl 2-methylprop-2-enoate.
| Compound Name | 3-[9-(dicyanomethylidene)thioxanthen-3-yl]sulfanylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 169065582 |
| Molecular Formula | C23H18N2O2S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 3-[9-(dicyanomethylidene)thioxanthen-3-yl]sulfanylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCSc1ccc2c(c1)Sc1ccccc1C2=C(C#N)C#N |
| InChI | InChI=1S/C23H18N2O2S2/c1-15(2)23(26)27-10-5-11-28-17-8-9-19-21(12-17)29-20-7-4-3-6-18(20)22(19)16(13-24)14-25/h3-4,6-9,12H,1,5,10-11H2,2H3 |
| InChIKey | PEXIDHRMFNDIMV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|