C29H28N2O6S — CID 169065588
3-[9-[1-cyano-2-[2-(2-methylprop-2-enoyloxy)ethylamino]-2-oxoethylidene]xanthen-3-yl]sulfanylpropyl 2-methylprop-2-enoate (PubChem CID 169065588) has the molecular formula C29H28N2O6S and a molecular weight of 532.62 g/mol. Its IUPAC name is 3-[9-[1-cyano-2-[2-(2-methylprop-2-enoyloxy)ethylamino]-2-oxoethylidene]xanthen-3-yl]sulfanylpropyl 2-methylprop-2-enoate.
| Compound Name | 3-[9-[1-cyano-2-[2-(2-methylprop-2-enoyloxy)ethylamino]-2-oxoethylidene]xanthen-3-yl]sulfanylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 169065588 |
| Molecular Formula | C29H28N2O6S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 3-[9-[1-cyano-2-[2-(2-methylprop-2-enoyloxy)ethylamino]-2-oxoethylidene]xanthen-3-yl]sulfanylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCSc1ccc2c(c1)Oc1ccccc1C2=C(C#N)C(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C29H28N2O6S/c1-18(2)28(33)35-13-7-15-38-20-10-11-22-25(16-20)37-24-9-6-5-8-21(24)26(22)23(17-30)27(32)31-12-14-36-29(34)19(3)4/h5-6,8-11,16H,1,3,7,12-15H2,2,4H3,(H,31,32) |
| InChIKey | SFDWXPCJNSBYEG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|