C22H16N2O4 — CID 155655950
2-[(9E)-9-[cyano(isocyano)methylidene]xanthen-3-yl]oxyethyl 2-methylprop-2-enoate (PubChem CID 155655950) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-[(9E)-9-[cyano(isocyano)methylidene]xanthen-3-yl]oxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(9E)-9-[cyano(isocyano)methylidene]xanthen-3-yl]oxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155655950 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-[(9E)-9-[cyano(isocyano)methylidene]xanthen-3-yl]oxyethyl 2-methylprop-2-enoate |
| SMILES | [C-]#[N+]/C(C#N)=C1\c2ccccc2Oc2cc(OCCOC(=O)C(=C)C)ccc21 |
| InChI | InChI=1S/C22H16N2O4/c1-14(2)22(25)27-11-10-26-15-8-9-17-20(12-15)28-19-7-5-4-6-16(19)21(17)18(13-23)24-3/h4-9,12H,1,10-11H2,2H3/b21-18+ |
| InChIKey | BPWKEPICDRRUJE-DYTRJAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|