C22H19N3O6 — CID 175345081
N-(2-amino-2-oxoethyl)-2-cyano-2-(1-hydroxyxanthen-9-ylidene)acetamide;2-methylprop-2-enoic acid (PubChem CID 175345081) has the molecular formula C22H19N3O6 and a molecular weight of 421.41 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2-cyano-2-(1-hydroxyxanthen-9-ylidene)acetamide;2-methylprop-2-enoic acid.
| Compound Name | N-(2-amino-2-oxoethyl)-2-cyano-2-(1-hydroxyxanthen-9-ylidene)acetamide;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 175345081 |
| Molecular Formula | C22H19N3O6 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2-cyano-2-(1-hydroxyxanthen-9-ylidene)acetamide;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.N#CC(C(=O)NCC(N)=O)=C1c2ccccc2Oc2cccc(O)c21 |
| InChI | InChI=1S/C18H13N3O4.C4H6O2/c19-8-11(18(24)21-9-15(20)23)16-10-4-1-2-6-13(10)25-14-7-3-5-12(22)17(14)16;1-3(2)4(5)6/h1-7,22H,9H2,(H2,20,23)(H,21,24);1H2,2H3,(H,5,6) |
| InChIKey | XUQWYPKVQZBJED-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 162.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|