C10H12N2O3 — CID 78993716
N-(2-amino-2-oxoethyl)-2-(2-hydroxyphenyl)acetamide (PubChem CID 78993716) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2-(2-hydroxyphenyl)acetamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 78993716 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2-(2-hydroxyphenyl)acetamide |
| SMILES | NC(=O)CNC(=O)Cc1ccccc1O |
| InChI | InChI=1S/C10H12N2O3/c11-9(14)6-12-10(15)5-7-3-1-2-4-8(7)13/h1-4,13H,5-6H2,(H2,11,14)(H,12,15) |
| InChIKey | RWRRCYLDAHRYBK-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |