C12H14ClNO4 — CID 103492759
methyl 2-chloro-3-[[2-(2-hydroxyphenyl)acetyl]amino]propanoate (PubChem CID 103492759) has the molecular formula C12H14ClNO4 and a molecular weight of 271.70 g/mol. Its IUPAC name is methyl 2-chloro-3-[[2-(2-hydroxyphenyl)acetyl]amino]propanoate.
| Compound Name | methyl 2-chloro-3-[[2-(2-hydroxyphenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 103492759 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | methyl 2-chloro-3-[[2-(2-hydroxyphenyl)acetyl]amino]propanoate |
| SMILES | COC(=O)C(Cl)CNC(=O)Cc1ccccc1O |
| InChI | InChI=1S/C12H14ClNO4/c1-18-12(17)9(13)7-14-11(16)6-8-4-2-3-5-10(8)15/h2-5,9,15H,6-7H2,1H3,(H,14,16) |
| InChIKey | XCQJAYIJLTWCQL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|