C24H36O8S — CID 158479065
6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate;2-(2-prop-2-enoyloxyethylsulfanyl)ethyl prop-2-enoate (PubChem CID 158479065) has the molecular formula C24H36O8S and a molecular weight of 484.61 g/mol. Its IUPAC name is 6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate;2-(2-prop-2-enoyloxyethylsulfanyl)ethyl prop-2-enoate.
| Compound Name | 6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate;2-(2-prop-2-enoyloxyethylsulfanyl)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 158479065 |
| Molecular Formula | C24H36O8S |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate;2-(2-prop-2-enoyloxyethylsulfanyl)ethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOC(=O)C(=C)C.C=CC(=O)OCCSCCOC(=O)C=C |
| InChI | InChI=1S/C14H22O4.C10H14O4S/c1-11(2)13(15)17-9-7-5-6-8-10-18-14(16)12(3)4;1-3-9(11)13-5-7-15-8-6-14-10(12)4-2/h1,3,5-10H2,2,4H3;3-4H,1-2,5-8H2 |
| InChIKey | HHHIFONYCPAHNJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|