C18H31NO6 — CID 159107941
butyl 2-methylprop-2-enoate;2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl prop-2-enoate (PubChem CID 159107941) has the molecular formula C18H31NO6 and a molecular weight of 357.45 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | butyl 2-methylprop-2-enoate;2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 159107941 |
| Molecular Formula | C18H31NO6 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | butyl 2-methylprop-2-enoate;2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC.C=CC(=O)OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H17NO4.C8H14O2/c1-5-8(12)14-7-6-11-9(13)15-10(2,3)4;1-4-5-6-10-8(9)7(2)3/h5H,1,6-7H2,2-4H3,(H,11,13);2,4-6H2,1,3H3 |
| InChIKey | KECWOUNARISGGM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|