C19H32N3O8+ — CID 123873336
dimethyl-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl]-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl]azanium (PubChem CID 123873336) has the molecular formula C19H32N3O8+ and a molecular weight of 430.48 g/mol. Its IUPAC name is dimethyl-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl]-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl]azanium.
| Compound Name | dimethyl-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl]-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 123873336 |
| Molecular Formula | C19H32N3O8+ |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | dimethyl-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethyl]-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl]azanium |
| SMILES | C=CC(=O)OCCNC(=O)OCC[N+](C)(C)CCOC(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C19H31N3O8/c1-6-16(23)27-11-7-20-18(25)29-13-9-22(4,5)10-14-30-19(26)21-8-12-28-17(24)15(2)3/h6H,1-2,7-14H2,3-5H3,(H-,20,21,25,26)/p+1 |
| InChIKey | ZPAYJEFCOVANOP-UHFFFAOYSA-O |
| XLogP | 0.36 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|