C10H16N2O4 — CID 91094626
2-[(but-2-en-2-ylamino)oxycarbonylamino]ethyl prop-2-enoate (PubChem CID 91094626) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-[(but-2-en-2-ylamino)oxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[(but-2-en-2-ylamino)oxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 91094626 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-[(but-2-en-2-ylamino)oxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)ONC(C)=CC |
| InChI | InChI=1S/C10H16N2O4/c1-4-8(3)12-16-10(14)11-6-7-15-9(13)5-2/h4-5,12H,2,6-7H2,1,3H3,(H,11,14) |
| InChIKey | VCEUPTCBXZXNCY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|