C20H22O2S — CID 118222523
5-(4-phenylphenyl)sulfanylpentyl prop-2-enoate (PubChem CID 118222523) has the molecular formula C20H22O2S and a molecular weight of 326.46 g/mol. Its IUPAC name is 5-(4-phenylphenyl)sulfanylpentyl prop-2-enoate.
| Compound Name | 5-(4-phenylphenyl)sulfanylpentyl prop-2-enoate |
|---|---|
| PubChem CID | 118222523 |
| Molecular Formula | C20H22O2S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-(4-phenylphenyl)sulfanylpentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCSc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22O2S/c1-2-20(21)22-15-7-4-8-16-23-19-13-11-18(12-14-19)17-9-5-3-6-10-17/h2-3,5-6,9-14H,1,4,7-8,15-16H2 |
| InChIKey | QTNGVSBSVRMUAB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|