C46H38O5S2 — CID 171608119
2-[4-[2-[4-[[2-methyl-4-[4-[2-[4-(2-prop-2-enoyloxyethylsulfanyl)phenyl]ethynyl]phenyl]phenoxy]methyl]phenyl]ethynyl]phenyl]sulfanylethyl prop-2-enoate (PubChem CID 171608119) has the molecular formula C46H38O5S2 and a molecular weight of 734.94 g/mol. Its IUPAC name is 2-[4-[2-[4-[[2-methyl-4-[4-[2-[4-(2-prop-2-enoyloxyethylsulfanyl)phenyl]ethynyl]phenyl]phenoxy]methyl]phenyl]ethynyl]phenyl]sulfanylethyl prop-2-enoate.
| Compound Name | 2-[4-[2-[4-[[2-methyl-4-[4-[2-[4-(2-prop-2-enoyloxyethylsulfanyl)phenyl]ethynyl]phenyl]phenoxy]methyl]phenyl]ethynyl]phenyl]sulfanylethyl prop-2-enoate |
|---|---|
| PubChem CID | 171608119 |
| Molecular Formula | C46H38O5S2 |
| Molecular Weight | 734.94 g/mol |
| Exact Mass | 734.22 |
| IUPAC Name | 2-[4-[2-[4-[[2-methyl-4-[4-[2-[4-(2-prop-2-enoyloxyethylsulfanyl)phenyl]ethynyl]phenyl]phenoxy]methyl]phenyl]ethynyl]phenyl]sulfanylethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCSc1ccc(C#Cc2ccc(COc3ccc(-c4ccc(C#Cc5ccc(SCCOC(=O)C=C)cc5)cc4)cc3C)cc2)cc1 |
| InChI | InChI=1S/C46H38O5S2/c1-4-45(47)49-28-30-52-42-23-16-37(17-24-42)8-6-35-10-12-39(13-11-35)33-51-44-27-22-41(32-34(44)3)40-20-14-36(15-21-40)7-9-38-18-25-43(26-19-38)53-31-29-50-46(48)5-2/h4-5,10-27,32H,1-2,28-31,33H2,3H3 |
| InChIKey | IJZQLEVVAJWWGZ-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.94 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|