C26H26O9 — CID 159139880
[2-methyl-4-[3-methyl-4,5-bis(prop-2-enoyloxymethoxy)phenyl]phenoxy]methyl prop-2-enoate (PubChem CID 159139880) has the molecular formula C26H26O9 and a molecular weight of 482.49 g/mol. Its IUPAC name is [2-methyl-4-[3-methyl-4,5-bis(prop-2-enoyloxymethoxy)phenyl]phenoxy]methyl prop-2-enoate.
| Compound Name | [2-methyl-4-[3-methyl-4,5-bis(prop-2-enoyloxymethoxy)phenyl]phenoxy]methyl prop-2-enoate |
|---|---|
| PubChem CID | 159139880 |
| Molecular Formula | C26H26O9 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | [2-methyl-4-[3-methyl-4,5-bis(prop-2-enoyloxymethoxy)phenyl]phenoxy]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCOc1ccc(-c2cc(C)c(OCOC(=O)C=C)c(OCOC(=O)C=C)c2)cc1C |
| InChI | InChI=1S/C26H26O9/c1-6-23(27)32-14-30-21-10-9-19(11-17(21)4)20-12-18(5)26(35-16-34-25(29)8-3)22(13-20)31-15-33-24(28)7-2/h6-13H,1-3,14-16H2,4-5H3 |
| InChIKey | DTFJYZBBTJOKJR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|