C42H36F2O6 — CID 171459675
3-[2-fluoro-4-[2-[4-[4-[2-[3-fluoro-4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]-2-methylphenyl]-3-methylphenyl]ethynyl]phenoxy]propyl prop-2-enoate (PubChem CID 171459675) has the molecular formula C42H36F2O6 and a molecular weight of 674.74 g/mol. Its IUPAC name is 3-[2-fluoro-4-[2-[4-[4-[2-[3-fluoro-4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]-2-methylphenyl]-3-methylphenyl]ethynyl]phenoxy]propyl prop-2-enoate.
| Compound Name | 3-[2-fluoro-4-[2-[4-[4-[2-[3-fluoro-4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]-2-methylphenyl]-3-methylphenyl]ethynyl]phenoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 171459675 |
| Molecular Formula | C42H36F2O6 |
| Molecular Weight | 674.74 g/mol |
| Exact Mass | 674.25 |
| IUPAC Name | 3-[2-fluoro-4-[2-[4-[4-[2-[3-fluoro-4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]-2-methylphenyl]-3-methylphenyl]ethynyl]phenoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc(C#Cc2ccc(-c3ccc(C#Cc4ccc(OCCCOC(=O)C=C)c(F)c4)cc3C)c(C)c2)cc1F |
| InChI | InChI=1S/C42H36F2O6/c1-5-41(45)49-23-7-21-47-39-19-15-33(27-37(39)43)11-9-31-13-17-35(29(3)25-31)36-18-14-32(26-30(36)4)10-12-34-16-20-40(38(44)28-34)48-22-8-24-50-42(46)6-2/h5-6,13-20,25-28H,1-2,7-8,21-24H2,3-4H3 |
| InChIKey | HXDQBAPKZQNGBY-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.74 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|