C31H32O5 — CID 134186879
[4-[2-(4-ethylphenyl)ethynyl]-2-methylphenyl] (3Z,5E)-2-methylidene-5-(3-prop-2-enoyloxypropoxy)hepta-3,5-dienoate (PubChem CID 134186879) has the molecular formula C31H32O5 and a molecular weight of 484.59 g/mol. Its IUPAC name is [4-[2-(4-ethylphenyl)ethynyl]-2-methylphenyl] (3Z,5E)-2-methylidene-5-(3-prop-2-enoyloxypropoxy)hepta-3,5-dienoate.
| Compound Name | [4-[2-(4-ethylphenyl)ethynyl]-2-methylphenyl] (3Z,5E)-2-methylidene-5-(3-prop-2-enoyloxypropoxy)hepta-3,5-dienoate |
|---|---|
| PubChem CID | 134186879 |
| Molecular Formula | C31H32O5 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | [4-[2-(4-ethylphenyl)ethynyl]-2-methylphenyl] (3Z,5E)-2-methylidene-5-(3-prop-2-enoyloxypropoxy)hepta-3,5-dienoate |
| SMILES | C=CC(=O)OCCCOC(/C=C\C(=C)C(=O)Oc1ccc(C#Cc2ccc(CC)cc2)cc1C)=C/C |
| InChI | InChI=1S/C31H32O5/c1-6-25-11-13-26(14-12-25)15-16-27-17-19-29(24(5)22-27)36-31(33)23(4)10-18-28(7-2)34-20-9-21-35-30(32)8-3/h7-8,10-14,17-19,22H,3-4,6,9,20-21H2,1-2,5H3/b18-10-,28-7+ |
| InChIKey | VAEVHKFLHLCCHP-URSKAQIMSA-N |
| XLogP | 6.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|