C38H40O6 — CID 172595095
ethane;3-[4-[2-[3-ethyl-4-[2-[4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]phenyl]ethynyl]phenoxy]propyl prop-2-enoate (PubChem CID 172595095) has the molecular formula C38H40O6 and a molecular weight of 592.73 g/mol. Its IUPAC name is ethane;3-[4-[2-[3-ethyl-4-[2-[4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]phenyl]ethynyl]phenoxy]propyl prop-2-enoate.
| Compound Name | ethane;3-[4-[2-[3-ethyl-4-[2-[4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]phenyl]ethynyl]phenoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 172595095 |
| Molecular Formula | C38H40O6 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | ethane;3-[4-[2-[3-ethyl-4-[2-[4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]phenyl]ethynyl]phenoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc(C#Cc2ccc(C#Cc3ccc(OCCCOC(=O)C=C)cc3)c(CC)c2)cc1.CC |
| InChI | InChI=1S/C36H34O6.C2H6/c1-4-31-27-30(10-9-28-13-19-33(20-14-28)39-23-7-25-41-35(37)5-2)12-18-32(31)17-11-29-15-21-34(22-16-29)40-24-8-26-42-36(38)6-3;1-2/h5-6,12-16,18-22,27H,2-4,7-8,23-26H2,1H3;1-2H3 |
| InChIKey | SGACXVNAEPRCNS-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|