C35H34O6 — CID 90231768
3-[4-[2-[2-methyl-4-[2-[4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]phenyl]ethynyl]cyclohexa-1,3-dien-1-yl]oxypropyl prop-2-enoate (PubChem CID 90231768) has the molecular formula C35H34O6 and a molecular weight of 550.65 g/mol. Its IUPAC name is 3-[4-[2-[2-methyl-4-[2-[4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]phenyl]ethynyl]cyclohexa-1,3-dien-1-yl]oxypropyl prop-2-enoate.
| Compound Name | 3-[4-[2-[2-methyl-4-[2-[4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]phenyl]ethynyl]cyclohexa-1,3-dien-1-yl]oxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 90231768 |
| Molecular Formula | C35H34O6 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 3-[4-[2-[2-methyl-4-[2-[4-(3-prop-2-enoyloxypropoxy)phenyl]ethynyl]phenyl]ethynyl]cyclohexa-1,3-dien-1-yl]oxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOC1=CC=C(C#Cc2ccc(C#Cc3ccc(OCCCOC(=O)C=C)cc3)cc2C)CC1 |
| InChI | InChI=1S/C35H34O6/c1-4-34(36)40-24-6-22-38-32-18-12-28(13-19-32)8-9-30-11-17-31(27(3)26-30)16-10-29-14-20-33(21-15-29)39-23-7-25-41-35(37)5-2/h4-5,11-14,17-20,26H,1-2,6-7,15,21-25H2,3H3 |
| InChIKey | OVBKIUGMQPYBST-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|