C54H56O8 — CID 171488376
pentyl 2,5-bis[2-[6-(6-prop-2-enoyloxyhexoxy)naphthalen-2-yl]ethynyl]benzoate (PubChem CID 171488376) has the molecular formula C54H56O8 and a molecular weight of 833.03 g/mol. Its IUPAC name is pentyl 2,5-bis[2-[6-(6-prop-2-enoyloxyhexoxy)naphthalen-2-yl]ethynyl]benzoate.
| Compound Name | pentyl 2,5-bis[2-[6-(6-prop-2-enoyloxyhexoxy)naphthalen-2-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 171488376 |
| Molecular Formula | C54H56O8 |
| Molecular Weight | 833.03 g/mol |
| Exact Mass | 832.40 |
| IUPAC Name | pentyl 2,5-bis[2-[6-(6-prop-2-enoyloxyhexoxy)naphthalen-2-yl]ethynyl]benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc2cc(C#Cc3ccc(C#Cc4ccc5cc(OCCCCCCOC(=O)C=C)ccc5c4)c(C(=O)OCCCCC)c3)ccc2c1 |
| InChI | InChI=1S/C54H56O8/c1-4-7-12-35-62-54(57)51-38-43(18-17-41-21-25-47-39-49(29-27-45(47)36-41)58-31-13-8-10-15-33-60-52(55)5-2)20-24-44(51)23-19-42-22-26-48-40-50(30-28-46(48)37-42)59-32-14-9-11-16-34-61-53(56)6-3/h5-6,20-22,24-30,36-40H,2-4,7-16,31-35H2,1H3 |
| InChIKey | DHJVDJDKIFIXHH-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.03 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|