C24H22O4 — CID 167443077
2-hydroxy-5-[2-(6-pentoxynaphthalen-2-yl)ethynyl]benzoic acid (PubChem CID 167443077) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-hydroxy-5-[2-(6-pentoxynaphthalen-2-yl)ethynyl]benzoic acid.
| Compound Name | 2-hydroxy-5-[2-(6-pentoxynaphthalen-2-yl)ethynyl]benzoic acid |
|---|---|
| PubChem CID | 167443077 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-hydroxy-5-[2-(6-pentoxynaphthalen-2-yl)ethynyl]benzoic acid |
| SMILES | CCCCCOc1ccc2cc(C#Cc3ccc(O)c(C(=O)O)c3)ccc2c1 |
| InChI | InChI=1S/C24H22O4/c1-2-3-4-13-28-21-11-10-19-14-17(7-9-20(19)16-21)5-6-18-8-12-23(25)22(15-18)24(26)27/h7-12,14-16,25H,2-4,13H2,1H3,(H,26,27) |
| InChIKey | MMESWVQBSPONME-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|