C24H23N2O4S2- — CID 170182352
2-[7-[cyclohexylmethyl(methyl)amino]-2-oxochromen-3-yl]-1,3-benzothiazole-6-sulfinate (PubChem CID 170182352) has the molecular formula C24H23N2O4S2- and a molecular weight of 467.59 g/mol. Its IUPAC name is 2-[7-[cyclohexylmethyl(methyl)amino]-2-oxochromen-3-yl]-1,3-benzothiazole-6-sulfinate.
| Compound Name | 2-[7-[cyclohexylmethyl(methyl)amino]-2-oxochromen-3-yl]-1,3-benzothiazole-6-sulfinate |
|---|---|
| PubChem CID | 170182352 |
| Molecular Formula | C24H23N2O4S2- |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-[7-[cyclohexylmethyl(methyl)amino]-2-oxochromen-3-yl]-1,3-benzothiazole-6-sulfinate |
| SMILES | CN(CC1CCCCC1)c1ccc2cc(-c3nc4ccc(S(=O)[O-])cc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/C24H24N2O4S2/c1-26(14-15-5-3-2-4-6-15)17-8-7-16-11-19(24(27)30-21(16)12-17)23-25-20-10-9-18(32(28)29)13-22(20)31-23/h7-13,15H,2-6,14H2,1H3,(H,28,29)/p-1 |
| InChIKey | SPCHPYCGOVOOKJ-UHFFFAOYSA-M |
| XLogP | 5.32 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|