C24H26N2O4 — CID 135576365
N-[(E)-1-(6-hexyl-7-hydroxy-2-oxochromen-3-yl)ethylideneamino]benzamide (PubChem CID 135576365) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is N-[(E)-1-(6-hexyl-7-hydroxy-2-oxochromen-3-yl)ethylideneamino]benzamide.
| Compound Name | N-[(E)-1-(6-hexyl-7-hydroxy-2-oxochromen-3-yl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 135576365 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-[(E)-1-(6-hexyl-7-hydroxy-2-oxochromen-3-yl)ethylideneamino]benzamide |
| SMILES | CCCCCCc1cc2cc(/C(C)=N/NC(=O)c3ccccc3)c(=O)oc2cc1O |
| InChI | InChI=1S/C24H26N2O4/c1-3-4-5-7-12-18-13-19-14-20(24(29)30-22(19)15-21(18)27)16(2)25-26-23(28)17-10-8-6-9-11-17/h6,8-11,13-15,27H,3-5,7,12H2,1-2H3,(H,26,28)/b25-16+ |
| InChIKey | HDEZNVMNXXZUKB-PCLIKHOPSA-N |
| XLogP | 4.78 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|