C24H24O4 — CID 71835705
6-hexyl-7-hydroxy-3-(3-phenylprop-2-enoyl)chromen-2-one (PubChem CID 71835705) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is 6-hexyl-7-hydroxy-3-(3-phenylprop-2-enoyl)chromen-2-one.
| Compound Name | 6-hexyl-7-hydroxy-3-(3-phenylprop-2-enoyl)chromen-2-one |
|---|---|
| PubChem CID | 71835705 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 6-hexyl-7-hydroxy-3-(3-phenylprop-2-enoyl)chromen-2-one |
| SMILES | CCCCCCc1cc2cc(C(=O)C=Cc3ccccc3)c(=O)oc2cc1O |
| InChI | InChI=1S/C24H24O4/c1-2-3-4-8-11-18-14-19-15-20(24(27)28-23(19)16-22(18)26)21(25)13-12-17-9-6-5-7-10-17/h5-7,9-10,12-16,26H,2-4,8,11H2,1H3 |
| InChIKey | ZLBPBHGOEHPYPV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|