C17H20O5 — CID 23085549
6-hexyl-7-methoxy-2-oxochromene-3-carboxylic acid (PubChem CID 23085549) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is 6-hexyl-7-methoxy-2-oxochromene-3-carboxylic acid.
| Compound Name | 6-hexyl-7-methoxy-2-oxochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 23085549 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 6-hexyl-7-methoxy-2-oxochromene-3-carboxylic acid |
| SMILES | CCCCCCc1cc2cc(C(=O)O)c(=O)oc2cc1OC |
| InChI | InChI=1S/C17H20O5/c1-3-4-5-6-7-11-8-12-9-13(16(18)19)17(20)22-15(12)10-14(11)21-2/h8-10H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | DMYUAUJDOVWFNX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|