C23H24N4O6 — CID 135549505
N-[(Z)-[amino-(6-hexyl-7-hydroxy-2-oxochromen-3-yl)methylidene]amino]-4-nitrobenzamide (PubChem CID 135549505) has the molecular formula C23H24N4O6 and a molecular weight of 452.47 g/mol. Its IUPAC name is N-[(Z)-[amino-(6-hexyl-7-hydroxy-2-oxochromen-3-yl)methylidene]amino]-4-nitrobenzamide.
| Compound Name | N-[(Z)-[amino-(6-hexyl-7-hydroxy-2-oxochromen-3-yl)methylidene]amino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 135549505 |
| Molecular Formula | C23H24N4O6 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-[(Z)-[amino-(6-hexyl-7-hydroxy-2-oxochromen-3-yl)methylidene]amino]-4-nitrobenzamide |
| SMILES | CCCCCCc1cc2cc(/C(N)=N/NC(=O)c3ccc([N+](=O)[O-])cc3)c(=O)oc2cc1O |
| InChI | InChI=1S/C23H24N4O6/c1-2-3-4-5-6-15-11-16-12-18(23(30)33-20(16)13-19(15)28)21(24)25-26-22(29)14-7-9-17(10-8-14)27(31)32/h7-13,28H,2-6H2,1H3,(H2,24,25)(H,26,29) |
| InChIKey | TYXZYEKNPHAKQN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 161.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|