C17H15N4O4+ — CID 135485328
N-[[amino-(6-methoxy-2-oxochromen-3-yl)methylidene]amino]pyridin-1-ium-4-carboxamide (PubChem CID 135485328) has the molecular formula C17H15N4O4+ and a molecular weight of 339.33 g/mol. Its IUPAC name is N-[[amino-(6-methoxy-2-oxochromen-3-yl)methylidene]amino]pyridin-1-ium-4-carboxamide.
| Compound Name | N-[[amino-(6-methoxy-2-oxochromen-3-yl)methylidene]amino]pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 135485328 |
| Molecular Formula | C17H15N4O4+ |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-[[amino-(6-methoxy-2-oxochromen-3-yl)methylidene]amino]pyridin-1-ium-4-carboxamide |
| SMILES | COc1ccc2oc(=O)c(C(N)=NNC(=O)c3cc[nH+]cc3)cc2c1 |
| InChI | InChI=1S/C17H14N4O4/c1-24-12-2-3-14-11(8-12)9-13(17(23)25-14)15(18)20-21-16(22)10-4-6-19-7-5-10/h2-9H,1H3,(H2,18,20)(H,21,22)/p+1 |
| InChIKey | DMAAXXUZYJLPLV-UHFFFAOYSA-O |
| XLogP | 0.67 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|