C32H50N4O8Si2 — CID 177421665
2-N,9-N-bis(3-triethoxysilylpropyl)-1,10-phenanthroline-2,9-dicarboxamide (PubChem CID 177421665) has the molecular formula C32H50N4O8Si2 and a molecular weight of 674.94 g/mol. Its IUPAC name is 2-N,9-N-bis(3-triethoxysilylpropyl)-1,10-phenanthroline-2,9-dicarboxamide.
| Compound Name | 2-N,9-N-bis(3-triethoxysilylpropyl)-1,10-phenanthroline-2,9-dicarboxamide |
|---|---|
| PubChem CID | 177421665 |
| Molecular Formula | C32H50N4O8Si2 |
| Molecular Weight | 674.94 g/mol |
| Exact Mass | 674.32 |
| IUPAC Name | 2-N,9-N-bis(3-triethoxysilylpropyl)-1,10-phenanthroline-2,9-dicarboxamide |
| SMILES | CCO[Si](CCCNC(=O)c1ccc2ccc3ccc(C(=O)NCCC[Si](OCC)(OCC)OCC)nc3c2n1)(OCC)OCC |
| InChI | InChI=1S/C32H50N4O8Si2/c1-7-39-45(40-8-2,41-9-3)23-13-21-33-31(37)27-19-17-25-15-16-26-18-20-28(36-30(26)29(25)35-27)32(38)34-22-14-24-46(42-10-4,43-11-5)44-12-6/h15-20H,7-14,21-24H2,1-6H3,(H,33,37)(H,34,38) |
| InChIKey | QYBSBMKJONFXQI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.94 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|