C36H44N4O4 — CID 23729749
N-hexyl-7-[2-[[2-(hexylcarbamoyl)-8-hydroxyquinolin-7-yl]methyl]prop-2-enyl]-8-hydroxyquinoline-2-carboxamide (PubChem CID 23729749) has the molecular formula C36H44N4O4 and a molecular weight of 596.77 g/mol. Its IUPAC name is N-hexyl-7-[2-[[2-(hexylcarbamoyl)-8-hydroxyquinolin-7-yl]methyl]prop-2-enyl]-8-hydroxyquinoline-2-carboxamide.
| Compound Name | N-hexyl-7-[2-[[2-(hexylcarbamoyl)-8-hydroxyquinolin-7-yl]methyl]prop-2-enyl]-8-hydroxyquinoline-2-carboxamide |
|---|---|
| PubChem CID | 23729749 |
| Molecular Formula | C36H44N4O4 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.34 |
| IUPAC Name | N-hexyl-7-[2-[[2-(hexylcarbamoyl)-8-hydroxyquinolin-7-yl]methyl]prop-2-enyl]-8-hydroxyquinoline-2-carboxamide |
| SMILES | C=C(Cc1ccc2ccc(C(=O)NCCCCCC)nc2c1O)Cc1ccc2ccc(C(=O)NCCCCCC)nc2c1O |
| InChI | InChI=1S/C36H44N4O4/c1-4-6-8-10-20-37-35(43)29-18-16-25-12-14-27(33(41)31(25)39-29)22-24(3)23-28-15-13-26-17-19-30(40-32(26)34(28)42)36(44)38-21-11-9-7-5-2/h12-19,41-42H,3-11,20-23H2,1-2H3,(H,37,43)(H,38,44) |
| InChIKey | YZAXGRPFJRMSNV-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|