C23H31NO7Si — CID 102284862
(4-benzoyl-2-hydroxyphenyl) N-(3-triethoxysilylpropyl)carbamate (PubChem CID 102284862) has the molecular formula C23H31NO7Si and a molecular weight of 461.59 g/mol. Its IUPAC name is (4-benzoyl-2-hydroxyphenyl) N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | (4-benzoyl-2-hydroxyphenyl) N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 102284862 |
| Molecular Formula | C23H31NO7Si |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | (4-benzoyl-2-hydroxyphenyl) N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)Oc1ccc(C(=O)c2ccccc2)cc1O)(OCC)OCC |
| InChI | InChI=1S/C23H31NO7Si/c1-4-28-32(29-5-2,30-6-3)16-10-15-24-23(27)31-21-14-13-19(17-20(21)25)22(26)18-11-8-7-9-12-18/h7-9,11-14,17,25H,4-6,10,15-16H2,1-3H3,(H,24,27) |
| InChIKey | OWJXQIJQVNNFGJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|