C23H37NO9Si — CID 58122245
ethyl 3-[2-oxo-2-[2-(3-triethoxysilylpropylcarbamoyloxy)ethoxy]ethyl]benzoate (PubChem CID 58122245) has the molecular formula C23H37NO9Si and a molecular weight of 499.63 g/mol. Its IUPAC name is ethyl 3-[2-oxo-2-[2-(3-triethoxysilylpropylcarbamoyloxy)ethoxy]ethyl]benzoate.
| Compound Name | ethyl 3-[2-oxo-2-[2-(3-triethoxysilylpropylcarbamoyloxy)ethoxy]ethyl]benzoate |
|---|---|
| PubChem CID | 58122245 |
| Molecular Formula | C23H37NO9Si |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | ethyl 3-[2-oxo-2-[2-(3-triethoxysilylpropylcarbamoyloxy)ethoxy]ethyl]benzoate |
| SMILES | CCOC(=O)c1cccc(CC(=O)OCCOC(=O)NCCC[Si](OCC)(OCC)OCC)c1 |
| InChI | InChI=1S/C23H37NO9Si/c1-5-28-22(26)20-12-9-11-19(17-20)18-21(25)29-14-15-30-23(27)24-13-10-16-34(31-6-2,32-7-3)33-8-4/h9,11-12,17H,5-8,10,13-16,18H2,1-4H3,(H,24,27) |
| InChIKey | OPTAAMJNQPJISQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|