C17H24N2O7S — CID 70796672
ethyl 3-[2-(3-methylsulfinylpropylcarbamoyloxy)ethoxycarbonylamino]benzoate (PubChem CID 70796672) has the molecular formula C17H24N2O7S and a molecular weight of 400.45 g/mol. Its IUPAC name is ethyl 3-[2-(3-methylsulfinylpropylcarbamoyloxy)ethoxycarbonylamino]benzoate.
| Compound Name | ethyl 3-[2-(3-methylsulfinylpropylcarbamoyloxy)ethoxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 70796672 |
| Molecular Formula | C17H24N2O7S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | ethyl 3-[2-(3-methylsulfinylpropylcarbamoyloxy)ethoxycarbonylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)OCCOC(=O)NCCCS(C)=O)c1 |
| InChI | InChI=1S/C17H24N2O7S/c1-3-24-15(20)13-6-4-7-14(12-13)19-17(22)26-10-9-25-16(21)18-8-5-11-27(2)23/h4,6-7,12H,3,5,8-11H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | YQMFAFZYGUWXBY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|