C10H18FNO4S2 — CID 166331088
3-[2-[[2-(3-fluoropropoxy)acetyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166331088) has the molecular formula C10H18FNO4S2 and a molecular weight of 299.39 g/mol. Its IUPAC name is 3-[2-[[2-(3-fluoropropoxy)acetyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[2-(3-fluoropropoxy)acetyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166331088 |
| Molecular Formula | C10H18FNO4S2 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 3-[2-[[2-(3-fluoropropoxy)acetyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | O=C(O)CCSSCCNC(=O)COCCCF |
| InChI | InChI=1S/C10H18FNO4S2/c11-3-1-5-16-8-9(13)12-4-7-18-17-6-2-10(14)15/h1-8H2,(H,12,13)(H,14,15) |
| InChIKey | VQWOIDGAJSYZKV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|