C53H100N4O8S2 — CID 143854640
3-[4-[2-[2-(2,5-diaminopentanoylamino)ethyldisulfanyl]ethylamino]-4-oxobutanoyl]oxypropyl (Z)-octadec-9-enoate;methyl (Z)-octadec-9-enoate (PubChem CID 143854640) has the molecular formula C53H100N4O8S2 and a molecular weight of 985.54 g/mol. Its IUPAC name is 3-[4-[2-[2-(2,5-diaminopentanoylamino)ethyldisulfanyl]ethylamino]-4-oxobutanoyl]oxypropyl (Z)-octadec-9-enoate;methyl (Z)-octadec-9-enoate.
| Compound Name | 3-[4-[2-[2-(2,5-diaminopentanoylamino)ethyldisulfanyl]ethylamino]-4-oxobutanoyl]oxypropyl (Z)-octadec-9-enoate;methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 143854640 |
| Molecular Formula | C53H100N4O8S2 |
| Molecular Weight | 985.54 g/mol |
| Exact Mass | 984.70 |
| IUPAC Name | 3-[4-[2-[2-(2,5-diaminopentanoylamino)ethyldisulfanyl]ethylamino]-4-oxobutanoyl]oxypropyl (Z)-octadec-9-enoate;methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC.CCCCCCCC/C=C\CCCCCCCC(=O)OCCCOC(=O)CCC(=O)NCCSSCCNC(=O)C(N)CCCN |
| InChI | InChI=1S/C34H64N4O6S2.C19H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-32(40)43-26-18-27-44-33(41)22-21-31(39)37-24-28-45-46-29-25-38-34(42)30(36)19-17-23-35;1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h9-10,30H,2-8,11-29,35-36H2,1H3,(H,37,39)(H,38,42);10-11H,3-9,12-18H2,1-2H3/b10-9-;11-10- |
| InChIKey | ZXIODAXKQACJQJ-SACPWDGRSA-N |
| XLogP | 12.16 |
| TPSA | 189.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.54 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|