C51H94N8O12 — CID 167159563
3-[2,6-bis[[4-[2-(2,6-diaminohexanoylamino)ethoxy]-4-oxobutanoyl]amino]hexanoyloxy]propyl (Z)-octadec-9-enoate (PubChem CID 167159563) has the molecular formula C51H94N8O12 and a molecular weight of 1011.36 g/mol. Its IUPAC name is 3-[2,6-bis[[4-[2-(2,6-diaminohexanoylamino)ethoxy]-4-oxobutanoyl]amino]hexanoyloxy]propyl (Z)-octadec-9-enoate.
| Compound Name | 3-[2,6-bis[[4-[2-(2,6-diaminohexanoylamino)ethoxy]-4-oxobutanoyl]amino]hexanoyloxy]propyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 167159563 |
| Molecular Formula | C51H94N8O12 |
| Molecular Weight | 1011.36 g/mol |
| Exact Mass | 1010.70 |
| IUPAC Name | 3-[2,6-bis[[4-[2-(2,6-diaminohexanoylamino)ethoxy]-4-oxobutanoyl]amino]hexanoyloxy]propyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCCOC(=O)C(CCCCNC(=O)CCC(=O)OCCNC(=O)C(N)CCCCN)NC(=O)CCC(=O)OCCNC(=O)C(N)CCCCN |
| InChI | InChI=1S/C51H94N8O12/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-27-46(62)68-37-23-38-71-51(67)43(59-45(61)29-31-48(64)70-40-36-58-50(66)42(55)25-18-21-33-53)26-19-22-34-56-44(60)28-30-47(63)69-39-35-57-49(65)41(54)24-17-20-32-52/h9-10,41-43H,2-8,11-40,52-55H2,1H3,(H,56,60)(H,57,65)(H,58,66)(H,59,61)/b10-9- |
| InChIKey | WZEHMTWYLDNQOH-KTKRTIGZSA-N |
| XLogP | 4.06 |
| TPSA | 325.68 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1011.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|