C54H102N6O8 — CID 88559616
[(2S)-3-[2,5-bis(2,5-diaminopentanoylamino)pentanoyloxy]-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate (PubChem CID 88559616) has the molecular formula C54H102N6O8 and a molecular weight of 963.44 g/mol. Its IUPAC name is [(2S)-3-[2,5-bis(2,5-diaminopentanoylamino)pentanoyloxy]-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [(2S)-3-[2,5-bis(2,5-diaminopentanoylamino)pentanoyloxy]-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 88559616 |
| Molecular Formula | C54H102N6O8 |
| Molecular Weight | 963.44 g/mol |
| Exact Mass | 962.78 |
| IUPAC Name | [(2S)-3-[2,5-bis(2,5-diaminopentanoylamino)pentanoyloxy]-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](COC(=O)C(CCCNC(=O)C(N)CCCN)NC(=O)C(N)CCCN)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C54H102N6O8/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-39-50(61)66-44-46(68-51(62)40-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)45-67-54(65)49(60-53(64)48(58)37-34-42-56)38-35-43-59-52(63)47(57)36-33-41-55/h17-20,46-49H,3-16,21-45,55-58H2,1-2H3,(H,59,63)(H,60,64)/b19-17-,20-18-/t46-,47?,48?,49?/m0/s1 |
| InChIKey | XAAKZSKVTFWEED-CHFUYXOCSA-N |
| XLogP | 9.57 |
| TPSA | 241.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 68 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.44 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|