C47H90N3O9P — CID 74763885
[3-[2-(2,5-diaminopentanoylamino)ethoxy-methoxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate (PubChem CID 74763885) has the molecular formula C47H90N3O9P and a molecular weight of 872.22 g/mol. Its IUPAC name is [3-[2-(2,5-diaminopentanoylamino)ethoxy-methoxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate.
| Compound Name | [3-[2-(2,5-diaminopentanoylamino)ethoxy-methoxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 74763885 |
| Molecular Formula | C47H90N3O9P |
| Molecular Weight | 872.22 g/mol |
| Exact Mass | 871.64 |
| IUPAC Name | [3-[2-(2,5-diaminopentanoylamino)ethoxy-methoxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCC/C=C/CCCCCCCC)COP(=O)(OC)OCCNC(=O)C(N)CCCN |
| InChI | InChI=1S/C47H90N3O9P/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-36-45(51)56-41-43(42-58-60(54,55-3)57-40-39-50-47(53)44(49)35-34-38-48)59-46(52)37-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,43-44H,4-17,22-42,48-49H2,1-3H3,(H,50,53)/b20-18+,21-19- |
| InChIKey | AFEKBSISQJYDIT-FXUQRDQZSA-N |
| XLogP | 11.49 |
| TPSA | 178.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.22 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|