C46H88N3O9P — CID 74763896
[3-[2-(2,4-diaminobutanoylamino)ethoxy-methoxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate (PubChem CID 74763896) has the molecular formula C46H88N3O9P and a molecular weight of 858.20 g/mol. Its IUPAC name is [3-[2-(2,4-diaminobutanoylamino)ethoxy-methoxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate.
| Compound Name | [3-[2-(2,4-diaminobutanoylamino)ethoxy-methoxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 74763896 |
| Molecular Formula | C46H88N3O9P |
| Molecular Weight | 858.20 g/mol |
| Exact Mass | 857.63 |
| IUPAC Name | [3-[2-(2,4-diaminobutanoylamino)ethoxy-methoxyphosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCC/C=C/CCCCCCCC)COP(=O)(OC)OCCNC(=O)C(N)CCN |
| InChI | InChI=1S/C46H88N3O9P/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-44(50)55-40-42(41-57-59(53,54-3)56-39-38-49-46(52)43(48)36-37-47)58-45(51)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,42-43H,4-17,22-41,47-48H2,1-3H3,(H,49,52)/b20-18+,21-19- |
| InChIKey | STZSQBNHENMYGU-FXUQRDQZSA-N |
| XLogP | 11.10 |
| TPSA | 178.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.20 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|