C47H88NO9P — CID 158038652
[(2S)-2-[(Z)-2-hexyldodec-3-enoyl]oxy-3-[methoxy-[2-(2-methylbutanoylamino)ethoxy]phosphoryl]oxypropyl] (E)-octadec-9-enoate (PubChem CID 158038652) has the molecular formula C47H88NO9P and a molecular weight of 842.19 g/mol. Its IUPAC name is [(2S)-2-[(Z)-2-hexyldodec-3-enoyl]oxy-3-[methoxy-[2-(2-methylbutanoylamino)ethoxy]phosphoryl]oxypropyl] (E)-octadec-9-enoate.
| Compound Name | [(2S)-2-[(Z)-2-hexyldodec-3-enoyl]oxy-3-[methoxy-[2-(2-methylbutanoylamino)ethoxy]phosphoryl]oxypropyl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 158038652 |
| Molecular Formula | C47H88NO9P |
| Molecular Weight | 842.19 g/mol |
| Exact Mass | 841.62 |
| IUPAC Name | [(2S)-2-[(Z)-2-hexyldodec-3-enoyl]oxy-3-[methoxy-[2-(2-methylbutanoylamino)ethoxy]phosphoryl]oxypropyl] (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\C(CCCCCC)C(=O)O[C@@H](COC(=O)CCCCCCC/C=C/CCCCCCCC)COP(=O)(OC)OCCNC(=O)C(C)CC |
| InChI | InChI=1S/C47H88NO9P/c1-7-11-14-17-19-21-22-23-24-25-26-27-29-31-34-37-45(49)54-40-44(41-56-58(52,53-6)55-39-38-48-46(50)42(5)10-4)57-47(51)43(35-32-16-13-9-3)36-33-30-28-20-18-15-12-8-2/h23-24,33,36,42-44H,7-22,25-32,34-35,37-41H2,1-6H3,(H,48,50)/b24-23+,36-33-/t42?,43?,44-,58?/m0/s1 |
| InChIKey | LGWGRJWJLNFFCU-CKODGOIKSA-N |
| XLogP | 13.32 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.19 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|