C43H81O8P — CID 158590041
[(2R)-3-[methoxy(propoxy)phosphoryl]oxy-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate (PubChem CID 158590041) has the molecular formula C43H81O8P and a molecular weight of 757.09 g/mol. Its IUPAC name is [(2R)-3-[methoxy(propoxy)phosphoryl]oxy-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate.
| Compound Name | [(2R)-3-[methoxy(propoxy)phosphoryl]oxy-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 158590041 |
| Molecular Formula | C43H81O8P |
| Molecular Weight | 757.09 g/mol |
| Exact Mass | 756.57 |
| IUPAC Name | [(2R)-3-[methoxy(propoxy)phosphoryl]oxy-2-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(OC)OCCC)OC(=O)CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C43H81O8P/c1-5-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-42(44)48-39-41(40-50-52(46,47-4)49-38-7-3)51-43(45)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-6-2/h20-23,41H,5-19,24-40H2,1-4H3/b22-20+,23-21+/t41-,52?/m1/s1 |
| InChIKey | HWWQESWVOWGGBW-PMQGJGBFSA-N |
| XLogP | 13.71 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.09 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|