C40H75O8P — CID 46891816
[(2R)-3-[hydroxy(methoxy)phosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate (PubChem CID 46891816) has the molecular formula C40H75O8P and a molecular weight of 715.01 g/mol. Its IUPAC name is [(2R)-3-[hydroxy(methoxy)phosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [(2R)-3-[hydroxy(methoxy)phosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 46891816 |
| Molecular Formula | C40H75O8P |
| Molecular Weight | 715.01 g/mol |
| Exact Mass | 714.52 |
| IUPAC Name | [(2R)-3-[hydroxy(methoxy)phosphoryl]oxy-2-[(Z)-octadec-9-enoyl]oxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C40H75O8P/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-39(41)46-36-38(37-47-49(43,44)45-3)48-40(42)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,38H,4-17,22-37H2,1-3H3,(H,43,44)/b20-18-,21-19-/t38-/m1/s1 |
| InChIKey | LKJBIXPVGXVZDZ-FLHMKPLESA-N |
| XLogP | 12.28 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.01 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|