C34H63O8P — CID 138233693
[1-[hydroxy(methoxy)phosphoryl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (Z)-hexadec-9-enoate (PubChem CID 138233693) has the molecular formula C34H63O8P and a molecular weight of 630.84 g/mol. Its IUPAC name is [1-[hydroxy(methoxy)phosphoryl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (Z)-hexadec-9-enoate.
| Compound Name | [1-[hydroxy(methoxy)phosphoryl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 138233693 |
| Molecular Formula | C34H63O8P |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.43 |
| IUPAC Name | [1-[hydroxy(methoxy)phosphoryl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (Z)-hexadec-9-enoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)OC)OC(=O)CCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C34H63O8P/c1-4-6-8-10-12-14-16-17-19-21-23-25-27-29-34(36)42-32(31-41-43(37,38)39-3)30-40-33(35)28-26-24-22-20-18-15-13-11-9-7-5-2/h11,13-14,16,32H,4-10,12,15,17-31H2,1-3H3,(H,37,38)/b13-11-,16-14- |
| InChIKey | PCIACUZOSXFDBH-IEFDFHFWSA-N |
| XLogP | 9.94 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|