C17H35NO3 — CID 172602784
5-methyl-5-[3-methyl-3-[2-(propylamino)ethoxy]butoxy]hexan-2-one (PubChem CID 172602784) has the molecular formula C17H35NO3 and a molecular weight of 301.47 g/mol. Its IUPAC name is 5-methyl-5-[3-methyl-3-[2-(propylamino)ethoxy]butoxy]hexan-2-one.
| Compound Name | 5-methyl-5-[3-methyl-3-[2-(propylamino)ethoxy]butoxy]hexan-2-one |
|---|---|
| PubChem CID | 172602784 |
| Molecular Formula | C17H35NO3 |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | 5-methyl-5-[3-methyl-3-[2-(propylamino)ethoxy]butoxy]hexan-2-one |
| SMILES | CCCNCCOC(C)(C)CCOC(C)(C)CCC(C)=O |
| InChI | InChI=1S/C17H35NO3/c1-7-11-18-12-14-21-17(5,6)10-13-20-16(3,4)9-8-15(2)19/h18H,7-14H2,1-6H3 |
| InChIKey | JQTVXMVXTHZWID-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|